CAS 92-04-6
:2-Chloro-4-phenylphenol
Description:
2-Chloro-4-phenylphenol, with the CAS number 92-04-6, is an organic compound that belongs to the class of chlorinated phenols. It is characterized by the presence of a chlorine atom and a phenyl group attached to a phenolic structure, which contributes to its chemical properties. This compound typically appears as a solid, often in a crystalline form, and is known for its white to light yellow color. It is slightly soluble in water but more soluble in organic solvents, reflecting its hydrophobic nature. 2-Chloro-4-phenylphenol exhibits antimicrobial properties, making it useful in various applications, including as a preservative and in antiseptic formulations. Additionally, it can serve as an intermediate in the synthesis of other chemical compounds. However, like many chlorinated phenols, it may pose environmental and health risks, necessitating careful handling and disposal. Its stability and reactivity can vary depending on the conditions, such as pH and temperature, influencing its behavior in different chemical environments.
Formula:C12H9ClO
InChI:InChI=1S/C12H9ClO/c13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9/h1-8,14H
InChI key:InChIKey=BZWMYDJJDBFAPE-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1O)C2=CC=CC=C2
Synonyms:- 2-Chloro-4-phenylphenol
- 2-Chloro-p-phenylphenol
- 3-Chloro-4-biphenylol
- 3-Chloro-4-hydroxybiphenyl
- 3-Chloro[1,1′-biphenyl]-4-ol
- 4-Biphenylol, 3-chloro-
- 4-Hydroxy-3-chlorobiphenyl
- 4-Phenyl-2-chlorophenol
- Dowicide 4
- NSC 3858
- Phenol, 2-chloro-4-phenyl-
- Sanidril
- [1,1′-Biphenyl]-4-ol, 3-chloro-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4-phenylphenol
CAS:Formula:C12H9ClOPurity:>96.0%(GC)Color and Shape:White to Light yellow to Light red powder to crystalMolecular weight:204.65[1,1'-Biphenyl]-4-ol, 3-chloro-
CAS:Formula:C12H9ClOPurity:96%Color and Shape:SolidMolecular weight:204.65232-Chloro-4-phenylphenol
CAS:2-Chloro-4-phenylphenol is a biphenyl compound that inhibits the growth of bacteria. It has an inhibitory effect on bacteria, and it also inhibits the production of bacterial enzymes. 2-Chloro-4-phenylphenol has been shown to have antimicrobial properties in vitro assays with subtilis. This compound is also used in polymer films for the prevention of microbial invasion. It has been shown to be effective against gram positive and gram negative bacteria such as Staphylococcus aureus, Escherichia coli, Klebsiella pneumoniae, and Pseudomonas aeruginosa. 2-Chloro-4-phenylphenol can be used as a preservative agent because it binds to hydroxyl groups or intramolecular hydrogen bonds on polymers and other substances and prevents them from forming bonds with microbes.Formula:C12H9ClOPurity:Min. 95%Molecular weight:204.65 g/mol





