CAS 92-16-0

N-(2-Methoxyphenyl)-β-oxobenzenepropanamide

Description:

N-(2-Methoxyphenyl)-β-oxobenzenepropanamide, also known by its CAS number 92-16-0, is an organic compound characterized by its amide functional group and aromatic structure. This compound features a propanamide backbone with a β-oxo group and a methoxy-substituted phenyl ring, contributing to its unique chemical properties. It typically exhibits moderate solubility in organic solvents due to its hydrophobic aromatic components, while its amide group can engage in hydrogen bonding, influencing its reactivity and interaction with other molecules. The presence of the methoxy group enhances its electron-donating ability, which can affect its reactivity in electrophilic aromatic substitution reactions. This compound may also display biological activity, making it of interest in pharmaceutical research. Its stability and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, N-(2-Methoxyphenyl)-β-oxobenzenepropanamide is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₆H₁₅NO₃

InChI: InChI=1S/C16H15NO3/c1-20-15-10-6-5-9-13(15)17-16(19)11-14(18)12-7-3-2-4-8-12/h2-10H,11H2,1H3,(H,17,19)

InChI key: InChIKey=FTYSHTGKLFLKRX-UHFFFAOYSA-N

SMILES: N(C(CC(=O)C1=CC=CC=C1)=O)C2=C(OC)C=CC=C2

Synonyms:

• Benzenepropanamide, N-(2-methoxyphenyl)-β-oxo-
• N-(2-Methoxyphenyl)-β-oxobenzenepropanamide
• o-Acetanisidide, 2-benzoyl-
• 2-Benzoyl-o-acetanisidide
• α-Benzoyl-o-methoxyacetanilide