CAS 92-25-1
:8-Amino-7-methyl-2-phenazinol
Description:
8-Amino-7-methyl-2-phenazinol, with the CAS number 92-25-1, is an organic compound belonging to the phenazine family, characterized by its distinct structural features that include an amino group and a methyl group attached to the phenazine core. This compound typically appears as a solid, often exhibiting a crystalline form. It is known for its potential applications in various fields, including dye chemistry and as a biological stain due to its ability to interact with cellular components. The presence of the amino group contributes to its reactivity, allowing it to participate in various chemical reactions, such as coupling reactions in dye synthesis. Additionally, 8-amino-7-methyl-2-phenazinol may exhibit specific optical properties, making it useful in photochemical applications. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, its unique chemical structure and properties make it a compound of interest in both industrial and research settings.
Formula:C13H11N3O
InChI:InChI=1/C13H11N3O/c1-7-4-11-13(6-9(7)14)16-12-5-8(17)2-3-10(12)15-11/h2-6,16H,14H2,1H3
InChI key:InChIKey=KWBJTBKOXIZLGY-UHFFFAOYSA-N
SMILES:NC1=CC2=C(N=C3C(=N2)C=C(O)C=C3)C=C1C
Synonyms:- 2-Methyl-3-amino-7-hydroxyphenazine
- 2-Phenazinol, 8-amino-7-methyl-
- 3-Amino-7-hydroxy-2-methylphenazine
- 8-Amino-7-methyl-2-phenazinol
- 8-amino-7-methylphenazin-2(10H)-one
- Brn 0018291
- Nsc 408737
- 5-25-13-00234 (Beilstein Handbook Reference)
- 8-Amino-7-methylphenazin-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.