
CAS 92-26-2
:3,6-Diamino-2,7-dimethylacridine
Description:
3,6-Diamino-2,7-dimethylacridine, with the CAS number 92-26-2, is an organic compound belonging to the acridine family, characterized by its polycyclic aromatic structure. This compound features two amino groups (-NH2) at the 3 and 6 positions and two methyl groups (-CH3) at the 2 and 7 positions of the acridine ring system. It is typically a solid at room temperature and exhibits a yellow to orange color. The presence of amino groups makes it a potential candidate for various chemical reactions, including those involving nucleophilic substitution and coupling reactions. 3,6-Diamino-2,7-dimethylacridine is of interest in fields such as medicinal chemistry and materials science due to its potential biological activity and ability to form complexes with metal ions. Additionally, it may exhibit fluorescence properties, making it useful in dye applications. However, handling this compound requires caution due to potential toxicity and environmental concerns associated with acridine derivatives.
Formula:C15H15N3
InChI:InChI=1S/C15H15N3/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16/h3-7H,16-17H2,1-2H3
InChI key:InChIKey=HGHJYCKSBMCGRK-UHFFFAOYSA-N
SMILES:CC1=CC2=C(N=C3C(=C2)C=C(C)C(N)=C3)C=C1N
Synonyms:- 3,6-Acridinediamine, 2,7-dimethyl-
- 2,7-Dimethyl-3,6-acridinediamine
- 3,6-Diamino-2,7-dimethylacridine
- Acridine, 3,6-diamino-2,7-dimethyl-
- Acridine Yellow base
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acridine Yellow
CAS:Acridine yellow, a yellow dye with bluish-green fluorescence, known as basic yellow K or H107.Formula:C15H15N3Color and Shape:Brown Or Red CrystalsMolecular weight:237.3
