CAS 92-26-2

3,6-Diamino-2,7-dimethylacridine

Description:

3,6-Diamino-2,7-dimethylacridine, with the CAS number 92-26-2, is an organic compound belonging to the acridine family, characterized by its polycyclic aromatic structure. This compound features two amino groups (-NH2) at the 3 and 6 positions and two methyl groups (-CH3) at the 2 and 7 positions of the acridine ring system. It is typically a solid at room temperature and exhibits a yellow to orange color. The presence of amino groups makes it a potential candidate for various chemical reactions, including those involving nucleophilic substitution and coupling reactions. 3,6-Diamino-2,7-dimethylacridine is of interest in fields such as medicinal chemistry and materials science due to its potential biological activity and ability to form complexes with metal ions. Additionally, it may exhibit fluorescence properties, making it useful in dye applications. However, handling this compound requires caution due to potential toxicity and environmental concerns associated with acridine derivatives.

Formula: C₁₅H₁₅N₃

InChI: InChI=1S/C15H15N3/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16/h3-7H,16-17H2,1-2H3

InChI key: InChIKey=HGHJYCKSBMCGRK-UHFFFAOYSA-N

SMILES: CC1=CC2=C(N=C3C(=C2)C=C(C)C(N)=C3)C=C1N

Synonyms:

• 3,6-Acridinediamine, 2,7-dimethyl-
• 2,7-Dimethyl-3,6-acridinediamine
• 3,6-Diamino-2,7-dimethylacridine
• Acridine, 3,6-diamino-2,7-dimethyl-
• Acridine Yellow base

Acridine Yellow

CAS: 92-26-2

Acridine yellow, a yellow dye with bluish-green fluorescence, known as basic yellow K or H107.

Formula: C₁₅H₁₅N₃

Color and Shape: Brown Or Red Crystals

Molecular weight: 237.3

Ref: TM-T29619