CAS 920-38-7
:2-Propynoic acid, sodium salt
Description:
2-Propynoic acid, sodium salt, also known as sodium propyne-2-carboxylate, is a sodium salt derived from 2-propynoic acid, which is an alkyne carboxylic acid. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the ionic sodium group. It is characterized by its ability to act as a weak acid, with the carboxylate group facilitating its reactivity in various chemical processes. The presence of the triple bond in the propynyl group contributes to its unique reactivity, making it useful in organic synthesis, particularly in the formation of more complex molecules. Additionally, 2-propynoic acid, sodium salt may exhibit antimicrobial properties, which can be advantageous in certain applications. As with many chemical substances, handling should be done with care, following appropriate safety guidelines to mitigate any potential hazards associated with its use.
Formula:C3H2O2·Na
InChI:InChI=1S/C3H2O2.Na/c1-2-3(4)5;/h1H,(H,4,5);
InChI key:InChIKey=MBTIGPJJQBDYNK-UHFFFAOYSA-N
SMILES:C(C#C)(O)=O.[Na]
Synonyms:- 2-Propynoic Acid, Sodium Salt (1:1)
- 2-Propynoic acid, sodium salt
- Acetylenecarboxylic acid sodium salt
- Propiolic acid, sodium salt
- Sodium propiolate
- Sodium propynoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Propiolic Acid Sodium Salt
CAS:Formula:C3H2NaO2Purity:98%Color and Shape:SolidMolecular weight:93.0366Propiolic acid sodium
CAS:Propiolic acid sodium salt (PAPS) is a corrosion inhibitor that prevents the formation of rust on metal surfaces. It contains a carbonyl group and a hydroxide ion. PAPS has been shown to react in a non-polar solvent such as n-dimethylformamide with nitrogen atoms or an amine to produce a proton, which can then be used to reduce fatty acids. This reaction is expressed in the following equation:
Formula:C3HNaO2Purity:Min. 95%Color and Shape:PowderMolecular weight:92.03 g/molPropiolic Acid Sodium Salt (90%)
CAS:Controlled ProductApplications A bactericidal and fungicidal.
References Schoppelrei, J., et al.: J. Phys. Chem., 100, 14343 (1996), Kolb, H., et al.: Drug Discovery Today, 8, 1128 (2003),Formula:C3HNaO2Purity:90%Color and Shape:NeatMolecular weight:92.03




