CAS 920-66-1: 1,1,1,3,3,3-Hexafluoro-2-propanol
Description:1,1,1,3,3,3-Hexafluoro-2-propanol, with the CAS number 920-66-1, is a fluorinated alcohol characterized by its unique structure that includes six fluorine atoms attached to a propane backbone. This compound is a colorless liquid at room temperature and is known for its high polarity and low volatility, which are attributed to the presence of multiple fluorine atoms. It exhibits strong hydrogen bonding capabilities due to the hydroxyl (-OH) group, making it a useful solvent in various chemical reactions, particularly in organic synthesis and as a reagent in fluorination processes. The presence of fluorine enhances its thermal stability and chemical resistance, making it suitable for applications in specialized fields such as pharmaceuticals and materials science. Additionally, 1,1,1,3,3,3-Hexafluoro-2-propanol is considered to have low toxicity, but safety precautions should still be observed when handling it due to its chemical properties. Overall, its unique characteristics make it a valuable compound in both research and industrial applications.
Formula:C3H2F6O
InChI:InChI=1S/C3H2F6O/c4-2(5,6)1(10)3(7,8)9/h1,10H
InChI key:InChIKey=BYEAHWXPCBROCE-UHFFFAOYSA-N
SMILES:FC(F)(F)C(O)C(F)(F)F
- Synonyms:
- 1,1,1,3,3,3-Hexafluoro-2-hydroxypropane
- 1,1,1,3,3,3-Hexafluoro-2-propanol
- 1,1,1,3,3,3-Hexafluoroisopropanol
- 1,1,1,3,3,3-Hexafluoroisopropyl alcohol
- 1,1,1,3,3,3-Hexafluoropropan-2-ol
- 1,1,1,3,3,3-Hexafluoropropane-2-Ol
- 1,1,1,3,3,3-Hexafluoropropanol
- 1,1,1,3,3,3-Hexafluorpropan-2-ol
- 2,2,2-Trifluoro-1-(trifluoromethyl)ethanol
- 2H-Hexafluoroisopropanol
- See more synonyms
- Bis(trifluoromethyl)methanol
- Hexafluoroisopropanol
- Hexafluoroisopropyl alcohol
- Nsc 96336
- Propan-2-Ol, 1,1,1,3,3,3-Hexafluoro-
- 2-Propanol, 1,1,1,3,3,3-hexafluoro-