CAS 92000-99-2

2-(cyclopent-1-en-1-yl)pentanoic acid

Description:

2-(Cyclopent-1-en-1-yl)pentanoic acid is an organic compound characterized by its unique structure, which includes a cyclopentene ring and a pentanoic acid moiety. This compound features a cyclopentene substituent at the second carbon of a pentanoic acid chain, contributing to its distinct reactivity and physical properties. It is likely to be a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents due to its hydrophobic hydrocarbon chain and polar carboxylic acid functional group. The presence of the cyclopentene ring may impart some degree of rigidity to the molecule, influencing its conformational behavior and potential interactions with other substances. As a carboxylic acid, it can participate in typical acid-base reactions and may serve as a precursor or intermediate in various synthetic pathways. Its unique structure may also confer specific biological activities, making it of interest in medicinal chemistry and materials science. However, detailed studies on its reactivity, stability, and potential applications would be necessary to fully understand its characteristics and utility.

Formula: C₁₀H₁₆O₂

InChI: InChI=1/C10H16O2/c1-2-5-9(10(11)12)8-6-3-4-7-8/h6,9H,2-5,7H2,1H3,(H,11,12)

SMILES: CCCC(C1=CCCC1)C(=O)O

Synonyms:

• 1-Cyclopentene-1-Acetic Acid, Alpha-Propyl-