CAS 92001-54-2

6-Chloro-8-(1-methylethyl)-9H-purine

Description:

6-Chloro-8-(1-methylethyl)-9H-purine, with the CAS number 92001-54-2, is a purine derivative characterized by its structural features that include a chlorine atom at the 6-position and an isopropyl group at the 8-position of the purine ring. This compound exhibits properties typical of purines, such as being a heterocyclic aromatic organic compound. It is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic isopropyl group. The presence of the chlorine atom can influence its reactivity and biological activity, potentially making it a candidate for various pharmacological applications. Compounds in this class often exhibit significant biological activity, including roles in nucleic acid metabolism and cellular signaling. As with many purine derivatives, it may also be involved in biochemical pathways, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₉ClN₄

InChI: InChI=1S/C8H9ClN4/c1-4(2)7-12-5-6(9)10-3-11-8(5)13-7/h3-4H,1-2H3,(H,10,11,12,13)

InChI key: InChIKey=CCXLFOMHQCRYGT-UHFFFAOYSA-N

SMILES: ClC1=C2C(N=C(C(C)C)N2)=NC=N1

Synonyms:

• 1H-Purine, 6-chloro-8-(1-methylethyl)-
• 6-Chloro-8-(1-methylethyl)-9H-purine
• 9H-Purine, 6-chloro-8-(1-methylethyl)-