
CAS 92013-12-2
:2-Butyl-1H-indene
Description:
2-Butyl-1H-indene is an organic compound characterized by its bicyclic structure, which consists of an indene core with a butyl substituent at the 2-position. This compound features a fused five-membered and six-membered ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive aromatic odor. The presence of the butyl group enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. 2-Butyl-1H-indene can participate in various chemical reactions, including electrophilic aromatic substitution and polymerization, due to the reactivity of the indene moiety. Its applications may extend to the synthesis of more complex organic molecules and materials, particularly in the fields of polymer chemistry and organic synthesis. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C13H16
InChI:InChI=1S/C13H16/c1-2-3-6-11-9-12-7-4-5-8-13(12)10-11/h4-5,7-9H,2-3,6,10H2,1H3
InChI key:InChIKey=RLFBCEPAILSHTL-UHFFFAOYSA-N
SMILES:C(CCC)C=1CC=2C(C1)=CC=CC2
Synonyms:- 1H-Indene, 2-butyl-
- 2-Butylindene
- 2-Butyl-1H-indene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.