CAS 92018-48-9
:3-methylbutyl bromo(phenyl)acetate
Description:
3-Methylbutyl bromo(phenyl)acetate, with the CAS number 92018-48-9, is an organic compound characterized by its ester functional group, which is formed from the reaction of a carboxylic acid and an alcohol. This compound features a bromo substituent on the phenyl ring, indicating the presence of a bromine atom, which can influence its reactivity and properties. The 3-methylbutyl group contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. The presence of the phenyl group adds to its aromatic nature, potentially affecting its stability and interaction with other molecules. This compound may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its synthesis typically involves esterification reactions, and it may be used as an intermediate in organic synthesis or as a flavoring agent due to its ester nature. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C13H17BrO2
InChI:InChI=1/C13H17BrO2/c1-10(2)8-9-16-13(15)12(14)11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3
SMILES:CC(C)CCOC(=O)C(c1ccccc1)Br
Synonyms:- Benzeneacetic acid, .alpha.-bromo-, 3-methylbutyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.