CAS 920297-31-0

Tetrahydro-4-(4-pyridinyl)-2H-pyran-4-carboxylic acid

Description:

Tetrahydro-4-(4-pyridinyl)-2H-pyran-4-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a pyran ring fused with a pyridine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The pyridine ring contributes to its aromatic character, which can influence its reactivity and interaction with biological systems. The presence of the carboxylic acid group suggests potential for hydrogen bonding, making it a candidate for various chemical reactions, including esterification and amidation. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Overall, Tetrahydro-4-(4-pyridinyl)-2H-pyran-4-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1S/C11H13NO3/c13-10(14)11(3-7-15-8-4-11)9-1-5-12-6-2-9/h1-2,5-6H,3-4,7-8H2,(H,13,14)

InChI key: InChIKey=JHCIOJVUYGAOPT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CCOCC1)C=2C=CN=CC2

Synonyms:

• 2H-Pyran-4-carboxylic acid, tetrahydro-4-(4-pyridinyl)-
• Tetrahydro-4-(4-pyridinyl)-2H-pyran-4-carboxylic acid