CymitQuimica logo

CAS 92033-81-3

:

Pyrrolidine, 1-[3-(4-nitrophenoxy)propyl]-

Description:
Pyrrolidine, 1-[3-(4-nitrophenoxy)propyl]- is an organic compound characterized by its pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The compound features a propyl chain substituted with a 4-nitrophenoxy group, contributing to its unique chemical properties. The presence of the nitro group (-NO2) on the phenyl ring enhances the compound's reactivity and polarity, making it potentially useful in various chemical applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Pyrrolidine derivatives are known for their biological activity, and the specific substitution pattern in this compound may influence its interaction with biological targets. Additionally, the compound's solubility, stability, and reactivity can be affected by the functional groups present, which may also dictate its behavior in different solvents or under varying conditions. Safety and handling precautions should be observed, as compounds with nitro groups can exhibit explosive properties under certain conditions.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c16-15(17)12-4-6-13(7-5-12)18-11-3-10-14-8-1-2-9-14/h4-7H,1-3,8-11H2
InChI key:JQLAYZSNLAOKEW-UHFFFAOYSA-N
SMILES:C1CCN(C1)CCCOC2=CC=C(C=C2)[N+](=O)[O-]
Synonyms:
  • 1-(3-(4-Nitrophenoxy)Propyl)Pyrrolidine
Found 2 products.