CAS 92036-78-7
:N'-cyclohexyl-N,N-diethylethane-1,2-diamine
Description:
N'-cyclohexyl-N,N-diethylethane-1,2-diamine, with CAS number 92036-78-7, is an organic compound characterized by its amine functional groups. It features a cyclohexyl group and two ethyl groups attached to a central ethane backbone, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinctive amine odor. It is soluble in organic solvents and exhibits moderate solubility in water, reflecting its amphiphilic nature. The presence of multiple amine groups allows it to engage in hydrogen bonding, influencing its reactivity and interaction with other substances. N'-cyclohexyl-N,N-diethylethane-1,2-diamine is often utilized in various applications, including as a curing agent in epoxy resins and as a chemical intermediate in the synthesis of other organic compounds. Safety considerations are important, as it may pose health risks upon exposure, necessitating proper handling and storage protocols. Overall, this compound is significant in both industrial and research contexts due to its versatile chemical behavior.
Formula:C12H26N2
InChI:InChI=1/C12H26N2/c1-3-14(4-2)11-10-13-12-8-6-5-7-9-12/h12-13H,3-11H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.