CAS 92041-22-0

1-Pyrrolidinepropionic acid, β-phenyl-, hydrochloride

Description:

1-Pyrrolidinepropionic acid, β-phenyl-, hydrochloride, with the CAS number 92041-22-0, is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a propionic acid moiety with a phenyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. It is often studied for its potential biological activities, including its role as a neurotransmitter or in pharmaceutical applications. The presence of the pyrrolidine ring contributes to its unique chemical reactivity and potential interactions with biological systems. As with many compounds, safety data should be consulted, as it may have specific handling and toxicity considerations. Overall, 1-Pyrrolidinepropionic acid, β-phenyl-, hydrochloride represents a class of compounds that may have significant implications in medicinal chemistry and pharmacology.

Formula: C₁₃H₁₇NO₂·ClH

InChI: InChI=1S/C13H17NO2.ClH/c15-13(16)10-12(14-8-4-5-9-14)11-6-2-1-3-7-11;/h1-3,6-7,12H,4-5,8-10H2,(H,15,16);1H

InChI key: InChIKey=XNHVBEDUPULMOF-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(C1=CC=CC=C1)N2CCCC2.Cl

Synonyms:

• 1-Pyrrolidinepropionic acid, β-phenyl-, hydrochloride