CAS 92041-43-5

1-[4-hydroxy-3-(morpholin-4-ylmethyl)phenyl]ethanone

Description:

1-[4-Hydroxy-3-(morpholin-4-ylmethyl)phenyl]ethanone, with the CAS number 92041-43-5, is an organic compound characterized by its phenolic structure and the presence of a morpholine ring. This compound features a ketone functional group (ethanone) attached to a phenolic moiety, which contributes to its potential reactivity and biological activity. The hydroxyl group (-OH) on the aromatic ring enhances its solubility in polar solvents and may influence its interaction with biological targets. The morpholine moiety, a six-membered ring containing both nitrogen and oxygen, is known for its ability to form hydrogen bonds, which can enhance the compound's pharmacological properties. This substance may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further studies, including its mechanism of action, toxicity, and efficacy in biological systems. Overall, the structural features of this compound suggest potential utility in pharmaceutical applications.

Formula: C₁₃H₁₇NO₃

InChI: InChI=1/C13H17NO3/c1-10(15)11-2-3-13(16)12(8-11)9-14-4-6-17-7-5-14/h2-3,8,16H,4-7,9H2,1H3

SMILES: CC(=O)c1ccc(c(c1)CN1CCOCC1)O

1-[4-Hydroxy-3-(morpholin-4-ylmethyl)phenyl]ethan-1-one

CAS: 92041-43-5

Versatile small molecule scaffold

Formula: C₁₃H₁₈ClNO₃

Purity: Min. 95%

Molecular weight: 271.74 g/mol

Ref: 3D-SDA04143