CAS 92042-93-8

(4-benzylpiperazin-1-yl)acetonitrile

Description:

(4-benzylpiperazin-1-yl)acetonitrile, with the CAS number 92042-93-8, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a benzyl group attached to the piperazine nitrogen at the 4-position and an acetonitrile group at the 1-position. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of both the benzyl and acetonitrile groups contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit properties such as being a potential ligand for various receptors or enzymes, and its structure suggests possible interactions with biological systems. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, (4-benzylpiperazin-1-yl)acetonitrile represents a versatile scaffold for further chemical modifications and investigations in pharmaceutical research.

Formula: C₁₃H₁₇N₃

InChI: InChI=1/C13H17N3/c14-6-7-15-8-10-16(11-9-15)12-13-4-2-1-3-5-13/h1-5H,7-12H2

SMILES: c1ccc(cc1)CN1CCN(CC#N)CC1

Synonyms:

• 1-Piperazineacetonitrile, 4-(Phenylmethyl)-

2-(4-Benzylpiperazin-1-yl)acetonitrile

CAS: 92042-93-8

Versatile small molecule scaffold

Formula: C₁₃H₁₇N₃

Purity: Min. 95%

Molecular weight: 215.29 g/mol

Ref: 3D-SDA04293