CAS 920461-58-1
:N-methyl-1-[2-(pyrrolidin-1-ylmethyl)phenyl]methanamine
Description:
N-methyl-1-[2-(pyrrolidin-1-ylmethyl)phenyl]methanamine, identified by its CAS number 920461-58-1, is a chemical compound that belongs to the class of amines. This substance features a central amine group, which is substituted with a methyl group and a phenyl ring that is further substituted with a pyrrolidine moiety. The presence of the pyrrolidine ring contributes to its potential biological activity, as this structure is often associated with various pharmacological properties. The compound is likely to exhibit moderate to high solubility in organic solvents due to its hydrophobic aromatic and aliphatic components. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through empirical studies. As with many amines, it may also participate in hydrogen bonding, influencing its physical and chemical behavior in different environments.
Formula:C13H20N2
InChI:InChI=1/C13H20N2/c1-14-10-12-6-2-3-7-13(12)11-15-8-4-5-9-15/h2-3,6-7,14H,4-5,8-11H2,1H3
SMILES:CNCc1ccccc1CN1CCCC1
Synonyms:- benzenemethanamine, N-methyl-2-(1-pyrrolidinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-methyl-1-[2-(pyrrolidin-1-ylmethyl)phenyl]methanamine
CAS:Formula:C13H20N2Molecular weight:204.3113
