CAS 920501-70-8
:1-(3-Thienyl)cyclopropanamine
Description:
1-(3-Thienyl)cyclopropanamine is an organic compound characterized by its unique structure, which includes a cyclopropane ring and a thienyl group. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound is typically classified as an amine due to the presence of the amine functional group (-NH2), which can participate in hydrogen bonding and influence its solubility in various solvents. The cyclopropane ring introduces strain, which can affect the compound's stability and reactivity, making it an interesting subject for synthetic and medicinal chemistry. Additionally, the presence of sulfur in the thienyl group may impart distinct electronic properties, potentially influencing biological activity. Overall, 1-(3-Thienyl)cyclopropanamine is of interest for its potential applications in pharmaceuticals and materials science, although specific biological activities and applications would require further investigation and research.
Formula:C7H9NS
InChI:InChI=1S/C7H9NS/c8-7(2-3-7)6-1-4-9-5-6/h1,4-5H,2-3,8H2
InChI key:InChIKey=UKWHKEFOAFKCEY-UHFFFAOYSA-N
SMILES:NC1(CC1)C=2C=CSC2
Synonyms:- Cyclopropanamine, 1-(3-thienyl)-
- 1-Thiophen-3-ylcyclopropan-1-amine
- 1-(3-Thienyl)cyclopropanamine
- 1-(Thiophen-3-yl)cyclopropan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.