CymitQuimica logo

CAS 920501-75-3

:

1-(2-Chloro-4-fluorophenyl)cyclopropanamine

Description:
1-(2-Chloro-4-fluorophenyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring attached to an amine group and a substituted phenyl group. The presence of a chlorine atom and a fluorine atom on the phenyl ring contributes to its reactivity and potential biological activity. This compound is typically classified as an aromatic amine due to the amine functional group (-NH2) bonded to an aromatic system. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as halogenated phenyl groups often enhance the biological properties of compounds. Additionally, the cyclopropane moiety can impart strain, which may influence the compound's reactivity and interaction with biological targets. Safety and handling considerations are essential, as with many amines and halogenated compounds, due to potential toxicity and environmental impact. Overall, 1-(2-Chloro-4-fluorophenyl)cyclopropanamine represents a compound of interest for further research in various chemical and pharmaceutical applications.
Formula:C9H9ClFN
InChI:InChI=1S/C9H9ClFN/c10-8-5-6(11)1-2-7(8)9(12)3-4-9/h1-2,5H,3-4,12H2
InChI key:InChIKey=HSXYMWHMEKDUJU-UHFFFAOYSA-N
SMILES:NC1(C2=C(Cl)C=C(F)C=C2)CC1
Synonyms:
  • 1-(2-Chlor-4-fluorphenyl)cyclopropanamin
  • 1-(2-Chloro-4-Fluorophenyl)Cyclopropanamine
  • 1-(2-Chloro-4-fluorophenyl)cyclopropan-1-amine
  • Cyclopropanamine, 1-(2-chloro-4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.