CymitQuimica logo

CAS 920501-77-5

:

1-(4-chloro-2-fluoro-phenyl)cyclopropanamine

Description:
1-(4-Chloro-2-fluoro-phenyl)cyclopropanamine is a chemical compound characterized by its unique structure, which includes a cyclopropane ring attached to an amine group and a phenyl ring substituted with both chlorine and fluorine atoms. The presence of the cyclopropane moiety contributes to its rigidity and potential reactivity, while the halogen substituents on the phenyl ring can influence its electronic properties and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular interactions can be affected by the electronegative chlorine and fluorine atoms, which can alter the compound's lipophilicity and binding affinity to biological targets. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, and its stability and reactivity can be assessed through various analytical methods. Overall, 1-(4-chloro-2-fluoro-phenyl)cyclopropanamine represents a class of compounds that may have potential applications in drug development and other chemical research fields.
Formula:C9H9ClFN
InChI:InChI=1/C9H9ClFN/c10-6-1-2-7(8(11)5-6)9(12)3-4-9/h1-2,5H,3-4,12H2
SMILES:c1cc(c(cc1Cl)F)C1(CC1)N
Synonyms:
  • 1-(4-Chlor-2-fluorphenyl)cyclopropanamin
  • 1-(4-Chloro-2-Fluorophenyl)Cyclopropanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.