
CAS 920511-30-4
:N-(4-Fluorophenyl)-3-azetidinamine
Description:
N-(4-Fluorophenyl)-3-azetidinamine, with the CAS number 920511-30-4, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic ring containing one nitrogen atom. The presence of the 4-fluorophenyl group indicates that a fluorine atom is substituted on the para position of a phenyl ring, contributing to the compound's unique electronic and steric properties. This substitution can influence the compound's reactivity, solubility, and biological activity. The azetidinamine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with azetidine structures are often explored for their therapeutic properties. Additionally, the presence of the amino group may facilitate interactions with biological targets, enhancing the compound's potential as a drug candidate. Overall, N-(4-Fluorophenyl)-3-azetidinamine exhibits characteristics typical of small organic molecules with potential applications in various fields, including drug discovery and development.
Formula:C9H11FN2
InChI:InChI=1S/C9H11FN2/c10-7-1-3-8(4-2-7)12-9-5-11-6-9/h1-4,9,11-12H,5-6H2
InChI key:InChIKey=BJUIFRGOYCPWPT-UHFFFAOYSA-N
SMILES:N(C1=CC=C(F)C=C1)C2CNC2
Synonyms:- 3-Azetidinamine, N-(4-fluorophenyl)-
- N-(4-Fluorophenyl)-3-azetidinamine
- 3-(4-Fluorophenylamino)azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.