CAS 92057-12-0
:3-thiophen-2-ylaniline
Description:
3-Thiophen-2-ylaniline, with the CAS number 92057-12-0, is an organic compound characterized by the presence of both an aniline group and a thiophene ring. This compound typically exhibits a molecular structure that includes a thiophene moiety substituted at the 2-position with an aniline group at the 3-position. The presence of the thiophene ring imparts unique electronic properties, making it of interest in various applications, including organic electronics and materials science. The compound is likely to be a solid at room temperature, with potential solubility in organic solvents due to its aromatic nature. Its chemical properties may include reactivity typical of both thiophenes and anilines, such as electrophilic substitution and potential interactions with various reagents. Additionally, the compound may exhibit interesting photophysical properties, making it suitable for use in dyes or as a building block in organic synthesis. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.
Formula:C10H9NS
InChI:InChI=1/C10H9NS/c11-9-4-1-3-8(7-9)10-5-2-6-12-10/h1-7H,11H2
InChI key:YUTPSMJOCLLMBK-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N)c1cccs1
Synonyms:- 3-(2-Thienyl)aniline
- 3-Thien-2-Ylaniline
- Benzenamine, 3-(2-thienyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(Thien-2-yl)aniline
CAS:3-(Thien-2-yl)anilineFormula:C10H9NSPurity:95%Color and Shape:Off-white SolidMolecular weight:175.250163-(Thiophen-2-yl)aniline
CAS:3-(Thiophen-2-yl)anilineFormula:C10H9NSPurity:95%Molecular weight:175.253-Thiophen-2-yl-phenylamine
CAS:Formula:C10H9NSPurity:98%Color and Shape:SolidMolecular weight:175.253-Thiophen-2-yl-phenylamine
CAS:Controlled ProductFormula:C10H9NSColor and Shape:NeatMolecular weight:175.253-(Thien-2-yl)aniline
CAS:3-(Thien-2-yl)aniline is a compound that can be used as an electron transport material in electrochemical studies. It has been shown to be capable of occluding and transferring electrons, which may be due to its ability to form thin films with a thickness of about 10 nm. 3-(Thien-2-yl)aniline is also magnetic and can undergo optical transitions when exposed to light, giving it the potential for use in photopolymerization and photoelectrochemistry. The nature of this compound is unknown, but it has been shown to inhibit fluorine on a thin film surface.
3-(Thien-2-yl)aniline may also be used as an electrode material in optical devices such as photocurrent generators or light emitting diodes (LEDs).Formula:C10H9NSPurity:Min. 95%Molecular weight:175.25 g/mol





