
CAS 920804-04-2
:Ethanone, 2-(ethylamino)-1-(3-fluorophenyl)-
Description:
Ethanone, 2-(ethylamino)-1-(3-fluorophenyl)-, also known by its CAS number 920804-04-2, is an organic compound characterized by its structure, which includes an ethanone moiety, an ethylamino group, and a 3-fluorophenyl substituent. This compound typically exhibits properties associated with both ketones and amines, such as being polar and capable of forming hydrogen bonds due to the presence of the amino group. The fluorine atom on the phenyl ring can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering electronic properties. Ethanolamine derivatives like this one may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions are essential, particularly due to potential toxicity associated with amine-containing substances.
Formula:C10H12FNO
InChI:InChI=1S/C10H12FNO/c1-2-12-7-10(13)8-4-3-5-9(11)6-8/h3-6,12H,2,7H2,1H3
InChI key:InChIKey=IWUOAYTXLCNOKC-UHFFFAOYSA-N
SMILES:C(CNCC)(=O)C1=CC(F)=CC=C1
Synonyms:- Ethanone, 2-(ethylamino)-1-(3-fluorophenyl)-
- 2-(Ethylamino)-1-(3-fluorophenyl)ethan-1-one
- 2-(Ethylamino)-1-(3-fluorophenyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.