CymitQuimica logo

CAS 920966-03-6

:

4-chloro-1H-pyrrolo[3,2-e]pyridine-5-carboxylic acid

Description:
4-Chloro-1H-pyrrolo[3,2-e]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a chlorine substituent at the 4-position of the pyrrole ring and a carboxylic acid functional group at the 5-position of the pyridine ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and drug development, particularly for its potential biological activities. Its unique structure allows for various chemical modifications, which can enhance its pharmacological properties. Additionally, the presence of the chlorine atom can influence its reactivity and interaction with biological targets. As with many heterocycles, it may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H5ClN2O2
InChI:InChI=1/C8H5ClN2O2/c9-6-4-1-2-10-7(4)11-3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:SJZMFAGWKZNYPX-UHFFFAOYSA-N
SMILES:c1cnc2c1c(c(c[nH]2)C(=O)O)Cl
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-5-carboxylic acid, 4-chloro-
  • 4-Chloro-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid
  • Acide 4-chloro-1H-pyrrolo[2,3-b]pyridine-5-carboxylique
  • T56 Bm Inj Fg Gvq
Found 4 products.