CAS 920966-30-9

Cyclohexanecarbonitrile, 3-amino-, hydrochloride (1:1), (1R,3R)-rel-

Description:

Cyclohexanecarbonitrile, 3-amino-, hydrochloride (1:1), (1R,3R)-rel- is a chemical compound characterized by its cyclic structure and the presence of both an amino group and a nitrile functional group. The compound features a cyclohexane ring, which contributes to its hydrophobic characteristics, while the amino group introduces basic properties, allowing it to form salts, such as the hydrochloride form. The presence of the hydrochloride indicates that the amino group is protonated, enhancing its solubility in water and making it suitable for various applications in pharmaceuticals and organic synthesis. The (1R,3R)-rel- designation indicates specific stereochemistry, which can influence the compound's biological activity and interactions. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. Overall, this compound's unique structural features and functional groups make it of interest in medicinal chemistry and related fields.

Formula: C₇H₁₂N₂·ClH

InChI: InChI=1/C7H12N2.ClH/c8-5-6-2-1-3-7(9)4-6;/h6-7H,1-4,9H2;1H/t6-,7-;/s2

InChI key: InChIKey=ZBUXGIYHCTWUTA-NSLAZIKQNA-N

SMILES: C(#N)[C@@H]1C[C@@H](N)CCC1.Cl

Synonyms:

• Cyclohexanecarbonitrile, 3-amino-, hydrochloride (1:1), (1R,3R)-rel-

trans-3-Cyanocyclohexylamine hydrochloride, 97%

CAS: 920966-30-9

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₇H₁₂N₂•HCl

Purity: 97%

Molecular weight: 160.64

Ref: 02-H62938