CAS 921-47-1

2,3,4-Trimethylhexane

Description:

2,3,4-Trimethylhexane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C11H24, indicating it consists of 11 carbon atoms and 24 hydrogen atoms. This compound is characterized by its structure, which features a hexane backbone with three methyl groups attached at the second, third, and fourth carbon positions. As a result, it exhibits a relatively high degree of branching, which influences its physical properties. 2,3,4-Trimethylhexane is a colorless liquid at room temperature and is typically insoluble in water but soluble in organic solvents. It has a relatively high boiling point compared to straight-chain alkanes of similar molecular weight due to its branched structure, which reduces the surface area available for intermolecular interactions. This compound is often used in research and industrial applications, particularly in the study of fuel properties and octane ratings, as it can serve as a reference compound in various chemical analyses. Its CAS number is 921-47-1, which uniquely identifies it in chemical databases.

Formula: C₉H₂₀

InChI: InChI=1S/C9H20/c1-6-8(4)9(5)7(2)3/h7-9H,6H2,1-5H3

InChI key: InChIKey=RUTNOQHQISEBGT-UHFFFAOYSA-N

SMILES: C(C(CC)C)(C(C)C)C

Synonyms:

• 2,3,4-Trimethylhexane
• Hexane, 2,3,4-trimethyl-

2,3,4-Trimethylhexane

CAS: 921-47-1

Formula: C₉H₂₀

Molecular weight: 128.26

Ref: 4Z-H-048022