CAS 921-62-0
:6-Phosphogluconic acid
Description:
6-Phosphogluconic acid is a biochemical compound that plays a significant role in the pentose phosphate pathway, which is crucial for cellular metabolism. It is a six-carbon sugar acid that contains a phosphate group, making it a phosphorylated derivative of gluconic acid. The molecular formula of 6-phosphogluconic acid is C6H11O8P, and it is typically found in its anionic form at physiological pH. This compound is characterized by its ability to participate in various enzymatic reactions, particularly those involving the conversion of glucose-6-phosphate to ribulose-5-phosphate. It is also involved in the production of NADPH, which is essential for anabolic reactions and maintaining cellular redox balance. In terms of physical properties, 6-phosphogluconic acid is soluble in water, reflecting its polar nature due to the presence of multiple hydroxyl and phosphate groups. Its role in metabolic pathways makes it an important intermediate in cellular respiration and biosynthesis, highlighting its significance in biochemistry and cellular physiology.
Formula:C6H13O10P
InChI:InChI=1S/C6H13O10P/c7-2(1-16-17(13,14)15)3(8)4(9)5(10)6(11)12/h2-5,7-10H,1H2,(H,11,12)(H2,13,14,15)/t2-,3-,4+,5-/m1/s1
InChI key:InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-N
SMILES:[C@H]([C@@H]([C@H](C(O)=O)O)O)([C@@H](COP(=O)(O)O)O)O
Synonyms:- 6-O-phosphono-D-gluconic acid
- 6-O-phosphonohexonic acid
- 6-Phospho-<span class="text-smallcaps">D</span>-gluconic acid
- 6-Phosphogluconate
- 6-Phosphogluconic acid
- <span class="text-smallcaps">D</span>-Gluconic acid 6-phosphate
- <span class="text-smallcaps">D</span>-Gluconic acid, 6-(dihydrogen phosphate)
- D-Gluconic acid 6-(dihydrogen phosphate)
- D-gluconic acid, 6-(dihydrogen phosphate), barium salt (2:3)
- Gluconic acid, 6-(dihydrogen phosphate), <span class="text-smallcaps">D</span>-
- Gluconic acid-6-phosphate
- Gluconic acid, 6-(dihydrogen phosphate), D-
- D-Gluconic acid 6-phosphate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Phosphogluconic Acid Barium Salt Hydrate
CAS:<p>6-Phosphogluconic Acid Barium Salt Hydrate</p>Molecular weight:958.2g/mol6-Phosphogluconic acid barium salt hydrate
CAS:Formula:C6H10O10PBa·H2OPurity:≥ 90% (dried basis)Color and Shape:White powderMolecular weight:958.20 (anhydrous)6-Phosphogluconic acid
CAS:<p>6-Phosphogluconic acid competitively inhibits PGI with Ki: 0.048 mM for glucose 6-P, 0.042 mM for fructose 6-P.</p>Formula:C6H13O10PPurity:98%Color and Shape:SolidMolecular weight:276.14



