CAS 92108-02-6
:ethyl 1-ethyl-2-methyl-1H-benzimidazole-5-carboxylate
Description:
Ethyl 1-ethyl-2-methyl-1H-benzimidazole-5-carboxylate, identified by its CAS number 92108-02-6, is a chemical compound that belongs to the class of benzimidazole derivatives. This compound features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring, contributing to its biological activity and potential pharmacological properties. The presence of ethyl and methyl substituents enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly as pharmaceuticals or agrochemicals. The carboxylate functional group suggests that it may participate in various chemical reactions, including esterification and amidation. Additionally, the compound's structural characteristics may allow for interactions with biological targets, making it a subject of interest in drug discovery and development. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on further empirical studies.
Formula:C13H16N2O2
InChI:InChI=1/C13H16N2O2/c1-4-15-9(3)14-11-8-10(6-7-12(11)15)13(16)17-5-2/h6-8H,4-5H2,1-3H3
SMILES:CCn1c(C)nc2cc(ccc12)C(=O)OCC
Synonyms:- 1-Ethyl-2-methyl-1H-benzoimidazole-5-carboxylic acid ethyl ester
- 1H-Benzimidazole-5-carboxylic acid, 1-ethyl-2-methyl-, ethyl ester
- Ethyl 1-ethyl-2-methyl-1H-benzimidazole-5-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Ethyl-2-methyl-1 H -benzoimidazole-5-carboxylic acid ethyl ester
CAS:Formula:C13H16N2O2Color and Shape:SolidMolecular weight:232.2831-Ethyl-2-methyl-1H-benzoimidazole-5-carboxylicacid ethyl ester
CAS:1-Ethyl-2-methyl-1H-benzoimidazole-5-carboxylicacid ethyl ester is a heterocyclic compound that is used in the synthesis of other organic compounds and pharmaceuticals. The absorption of light at wavelengths from 400 nm to 700 nm leads to the formation of an excited state, which can undergo electron transfer reactions with other molecules. This process is called photochemistry.Formula:C13H16N2O2Purity:Min. 95%Molecular weight:232.28 g/mol

