CymitQuimica logo

CAS 921101-66-8

:

N-methyl-1-(2-phenylthiazol-4-yl)methanamine

Description:
N-methyl-1-(2-phenylthiazol-4-yl)methanamine, with the CAS number 921101-66-8, is a chemical compound characterized by its unique structure, which includes a thiazole ring and an amine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the thiazole moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the N-methyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's stability, reactivity, and interaction with biological targets can vary based on environmental conditions, such as pH and temperature. Overall, N-methyl-1-(2-phenylthiazol-4-yl)methanamine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C11H12N2S
InChI:InChI=1/C11H12N2S/c1-12-7-10-8-14-11(13-10)9-5-3-2-4-6-9/h2-6,8,12H,7H2,1H3
SMILES:CNCc1csc(c2ccccc2)n1
Synonyms:
  • 4-thiazolemethanamine, N-methyl-2-phenyl-
  • N-Methyl-1-(2-phenyl-1,3-thiazol-4-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.