
CAS 921102-37-6
:(4-METHOXY-BENZYL)-[1-(2-METHYL-THIAZOL-4-YL)-ETHYL]-AMINE
Description:
(4-Methoxy-benzyl)-[1-(2-methyl-thiazol-4-yl)-ethyl]-amine, with the CAS number 921102-37-6, is a chemical compound characterized by its complex structure that includes a methoxy group, a benzyl moiety, and a thiazole ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the thiazole ring may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the methoxy group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. As with many organic compounds, the stability and reactivity of this substance can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance.
Formula:C14H18N2OS
InChI:InChI=1S/C14H18N2OS/c1-10(14-9-18-11(2)16-14)15-8-12-4-6-13(17-3)7-5-12/h4-7,9-10,15H,8H2,1-3H3
InChI key:AOYGNKWYXJKAIN-UHFFFAOYSA-N
SMILES:CC1=NC(=CS1)C(C)NCC2=CC=C(C=C2)OC
Synonyms:- 4-Thiazolemethanamine, N-[(4-methoxyphenyl)methyl]-α,2-dimethyl-
- (4-METHOXY-BENZYL)-[1-(2-METHYL-THIAZOL-4-YL)-ETHYL]-AMINE
- N-(4-Methoxybenzyl)-1-(2-methyl-1,3-thiazol-4-yl)-ethanamine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery