CAS 92116-67-1

N~6~,3-dimethylquinoxaline-5,6-diamine

Description:

N~6~,3-dimethylquinoxaline-5,6-diamine is a chemical compound characterized by its quinoxaline structure, which consists of a bicyclic aromatic system containing two nitrogen atoms. This compound features two methyl groups at the N-3 and N-6 positions, contributing to its unique properties. The presence of amino groups at the 5 and 6 positions enhances its reactivity and solubility in various solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in pharmaceutical research, particularly in the development of antimicrobial or anticancer agents. The molecular structure allows for potential interactions with biological targets, and its derivatives may be synthesized for enhanced efficacy. Additionally, the compound's stability and solubility characteristics can vary based on the pH and solvent environment, which is crucial for its application in biological systems. Overall, N~6~,3-dimethylquinoxaline-5,6-diamine represents a significant class of compounds with diverse applications in medicinal chemistry and material science.

Formula: C₁₀H₁₂N₄

InChI: InChI=1/C10H12N4/c1-6-5-13-8-4-3-7(12-2)9(11)10(8)14-6/h3-5,12H,11H2,1-2H3

SMILES: Cc1cnc2ccc(c(c2n1)N)NC