CymitQuimica logo

CAS 92132-03-1

:

1H-Imidazole-4-carboxylic acid, 5-amino-2-methyl-, ethyl ester, hydrochloride (1:1)

Description:
1H-Imidazole-4-carboxylic acid, 5-amino-2-methyl-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group and an amino group, contributing to its potential as a biological and pharmaceutical agent. The ethyl ester moiety enhances its solubility and bioavailability, making it suitable for various applications. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. The compound may exhibit properties such as antimicrobial or antifungal activity, owing to the presence of the imidazole ring, which is common in many biologically active molecules. Its molecular interactions can be influenced by the presence of the amino and carboxylic acid groups, allowing for potential hydrogen bonding and ionic interactions. Overall, this compound's unique structure and functional groups make it of interest in medicinal chemistry and drug development.
Formula:C7H11N3O2·ClH
InChI:InChI=1S/C7H11N3O2.ClH/c1-3-12-7(11)5-6(8)10-4(2)9-5;/h3,8H2,1-2H3,(H,9,10);1H
InChI key:InChIKey=KOVRHXHXFXBKBN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N)N=C(C)N1.Cl
Synonyms:
  • 1H-Imidazole-4-carboxylic acid, 5-amino-2-methyl-, ethyl ester, hydrochloride (1:1)
  • 1H-Imidazole-4-carboxylic acid, 5-amino-2-methyl-, ethyl ester, monohydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.