CymitQuimica logo

CAS 92135-04-1

:

2-{[(5-methylhexyl)oxy]carbonyl}benzoic acid

Description:
2-{[(5-methylhexyl)oxy]carbonyl}benzoic acid, identified by its CAS number 92135-04-1, is an organic compound characterized by its benzoic acid structure modified with a carbonyl group and a 5-methylhexyl ether substituent. This compound features a carboxylic acid functional group, which imparts acidic properties, and an ester-like moiety that enhances its hydrophobic characteristics due to the long alkyl chain. The presence of the 5-methylhexyl group contributes to its lipophilicity, potentially influencing its solubility in organic solvents rather than in water. The compound may exhibit interesting properties such as thermal stability and reactivity typical of carboxylic acids, making it relevant in various chemical applications, including pharmaceuticals and materials science. Additionally, its structural features suggest potential for interactions in biological systems, which could be explored for drug development or as a surfactant. Overall, the unique combination of functional groups in this compound provides a basis for diverse chemical behavior and applications.
Formula:C15H20O4
InChI:InChI=1/C15H20O4/c1-11(2)7-5-6-10-19-15(18)13-9-4-3-8-12(13)14(16)17/h3-4,8-9,11H,5-7,10H2,1-2H3,(H,16,17)
SMILES:CC(C)CCCCOC(=O)c1ccccc1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.