CAS 92138-35-7

6-chloro-3-nitropyridin-2(1H)-one

Description:

6-Chloro-3-nitropyridin-2(1H)-one is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom and a nitro group. The presence of the chlorine atom at the 6-position and the nitro group at the 3-position contributes to its unique reactivity and properties. This compound typically appears as a solid and is soluble in polar organic solvents. It exhibits potential biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or anticancer agents. The nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution, while the pyridine ring can engage in coordination with metal ions. Additionally, the compound's structure allows for various synthetic modifications, which can enhance its biological activity or alter its physicochemical properties. Safety data should be consulted, as compounds with halogen and nitro substituents can pose health risks and require careful handling.

Formula: C₅H₃ClN₂O₃

InChI: InChI=1/C5H3ClN2O3/c6-4-2-1-3(8(10)11)5(9)7-4/h1-2H,(H,7,9)

SMILES: c1cc(Cl)nc(c1N(=O)=O)O

Synonyms:

• 2-Pyridinol, 6-Chloro-3-Nitro-
• 6-Chloro-3-nitropyridin-2-ol
• 2-Hydroxy-3-Nitro-6-Cloropyridine
• 2-Hydroxy-3-Nitro-6-Chloropyridine

6-Chloro-3-nitropyridin-2(1H)-one

CAS: 92138-35-7

Formula: C₅H₃ClN₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 174.5419

Ref: IN-DA0036X8

6-Chloro-2-hydroxy-3-nitropyridine

CAS: 92138-35-7

6-Chloro-2-hydroxy-3-nitropyridine

Purity: 97%

Molecular weight: 174.54g/mol

Ref: 54-OR345155

6-Chloro-3-nitropyridin-2-ol

CAS: 92138-35-7

Formula: C₅H₃ClN₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.54

Ref: 10-F209657