CAS 92142-32-0

1-[(1S,6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethanone

Description:

1-[(1S,6S)-9-azabicyclo[4.2.1]non-2-en-2-yl]ethanone, with the CAS number 92142-32-0, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom within the ring system, contributing to its classification as an azabicyclic compound. This substance features a ketone functional group (ethanone) attached to a bicyclic framework, which influences its reactivity and potential biological activity. The stereochemistry indicated by the (1S,6S) configuration suggests specific spatial arrangements of atoms, which can significantly affect the compound's properties, including its interaction with biological targets. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the bicyclic structure often leads to unique conformational characteristics, which can impact solubility, stability, and overall chemical behavior. As with many nitrogen-containing heterocycles, this compound may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, depending on the reaction conditions.

Formula: C₁₀H₁₅NO

InChI: InChI=1/C10H15NO/c1-7(12)9-4-2-3-8-5-6-10(9)11-8/h4,8,10-11H,2-3,5-6H2,1H3/t8-,10-/m0/s1

SMILES: CC(=O)C1=CCC[C@H]2CC[C@@H]1N2