CAS 92146-76-4

3-(Benzyloxy)cyclobutanamine hydrochloride (1:1)

Description:

3-(Benzyloxy)cyclobutanamine hydrochloride is a chemical compound characterized by its unique structure, which includes a cyclobutane ring substituted with a benzyloxy group and an amine functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The presence of the benzyloxy group enhances its lipophilicity, potentially influencing its biological activity and pharmacokinetic properties. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may be of interest in medicinal chemistry and pharmaceutical research, particularly for its potential applications in drug development. Its specific interactions and reactivity can be influenced by the functional groups present, making it a subject of study for various chemical and biological applications. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₆ClNO

InChI: InChI=1/C11H15NO.ClH/c12-10-6-11(7-10)13-8-9-4-2-1-3-5-9;/h1-5,10-11H,6-8,12H2;1H

Synonyms:

• cyclobutanamine, 3-(phenylmethoxy)-, hydrochloride (1:1)

3-(Benzyloxy)cyclobutan-1-amine hydrochloride

CAS: 92146-76-4

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO

Purity: Min. 95%

Molecular weight: 213.7 g/mol

Ref: 3D-SDA14676