CAS 92151-02-5
:5-(2,4-dichlorophenyl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:
5-(2,4-Dichlorophenyl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with the CAS number 92151-02-5, is a chemical compound that belongs to the class of triazoles, which are five-membered heterocyclic compounds containing three nitrogen atoms. This particular compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the triazole ring. The presence of the 2,4-dichlorophenyl and phenyl substituents contributes to its potential biological activity and lipophilicity. The compound may exhibit various properties such as antimicrobial, antifungal, or herbicidal activities, making it of interest in agricultural and pharmaceutical applications. Its structure suggests that it could participate in various chemical reactions typical of thiones and triazoles, including nucleophilic substitutions and coordination with metal ions. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental conditions such as pH and temperature. Safety data and handling precautions should be consulted when working with this substance.
Formula:C14H9Cl2N3S
InChI:InChI=1/C14H9Cl2N3S/c15-9-6-7-11(12(16)8-9)13-17-18-14(20)19(13)10-4-2-1-3-5-10/h1-8H,(H,18,20)
SMILES:c1ccc(cc1)n1c(c2ccc(cc2Cl)Cl)nnc1S
Synonyms:- 3H-1,2,4-triazole-3-thione, 5-(2,4-dichlorophenyl)-2,4-dihydro-4-phenyl-
- 4H-1,2,4-Triazole-3-thiol, 5-(2,4-dichlorophenyl)-4-phenyl-
- 5-(2,4-Dichlorophenyl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
