CAS 92152-60-8

2-(4-bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone

Description:

2-(4-bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone, with the CAS number 92152-60-8, is an organic compound characterized by its complex structure featuring a bromophenyl group and a dihydroxyphenyl moiety. This compound typically exhibits a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, including substitution and coupling reactions. The two hydroxyl groups on the dihydroxyphenyl part of the molecule can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2-(4-bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone is a versatile compound with potential applications in various fields of chemistry and biology.

Formula: C₁₄H₁₁BrO₃

InChI: InChI=1/C14H11BrO3/c15-10-3-1-9(2-4-10)7-13(17)12-6-5-11(16)8-14(12)18/h1-6,8,16,18H,7H2

SMILES: c1cc(ccc1CC(=O)c1ccc(cc1O)O)Br

2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone

CAS: 92152-60-8

Formula: C₁₄H₁₁BrO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 307.1393

Ref: IN-DA0065AF

2-(4-Bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone

CAS: 92152-60-8

Formula: C₁₄H₁₁BrO₃

Purity: 95.0%

Molecular weight: 307.143

Ref: 10-F213198