CAS 92155-73-2
:8-oxotridecanoic acid
Description:
8-Oxotridecanoic acid, also known by its CAS number 92155-73-2, is a fatty acid characterized by a long hydrocarbon chain with a ketone functional group at the eighth carbon position. This compound typically features a straight-chain structure, which is common among fatty acids, and its molecular formula reflects the presence of both carbon and oxygen atoms. The presence of the keto group introduces unique reactivity and properties compared to its saturated counterparts. 8-Oxotridecanoic acid may exhibit amphiphilic characteristics, allowing it to interact with both hydrophilic and hydrophobic environments, which can be significant in biological systems and applications in surfactants or emulsifiers. Additionally, the compound may play a role in various biochemical pathways, particularly in lipid metabolism and oxidative stress responses. Its stability, solubility, and reactivity can vary based on environmental conditions, making it a subject of interest in both synthetic and natural product chemistry.
Formula:C13H24O3
InChI:InChI=1/C13H24O3/c1-2-3-6-9-12(14)10-7-4-5-8-11-13(15)16/h2-11H2,1H3,(H,15,16)
SMILES:CCCCCC(=O)CCCCCCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.