CymitQuimica logo

CAS 921592-86-1

:

(3R)-1-(5-Amino-2-pyridinyl)-3-pyrrolidinol

Description:
(3R)-1-(5-Amino-2-pyridinyl)-3-pyrrolidinol, with the CAS number 921592-86-1, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a pyrrolidine ring, which contributes to its cyclic structure, and an amino group attached to a pyridine ring, indicating potential for hydrogen bonding and interactions with biological targets. The presence of both the pyridine and pyrrolidine moieties suggests that this compound may exhibit interesting pharmacological properties, potentially acting as a ligand in various biological systems. Its stereochemistry, denoted by the (3R) configuration, implies that it has a specific three-dimensional arrangement, which can significantly influence its biological activity and interactions. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or other disorders, due to its structural features that allow for specific receptor binding. Overall, (3R)-1-(5-Amino-2-pyridinyl)-3-pyrrolidinol represents a unique chemical entity with potential applications in drug discovery and development.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c10-7-1-2-9(11-5-7)12-4-3-8(13)6-12/h1-2,5,8,13H,3-4,6,10H2/t8-/m1/s1
InChI key:InChIKey=KTZANZYEZRAGNO-MRVPVSSYSA-N
SMILES:O[C@H]1CN(C2=CC=C(N)C=N2)CC1
Synonyms:
  • 3-Pyrrolidinol, 1-(5-amino-2-pyridinyl)-, (3R)-
  • (3R)-1-(5-Aminopyridin-2-yl)pyrrolidin-3-ol
  • (3R)-1-(5-Amino-2-pyridinyl)-3-pyrrolidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.