
CAS 921602-59-7
:1-(Chloromethyl)-3-(1-cyclopropylethoxy)benzene
Description:
1-(Chloromethyl)-3-(1-cyclopropylethoxy)benzene, with the CAS number 921602-59-7, is an organic compound characterized by its aromatic structure, which includes a chloromethyl group and a cyclopropylethoxy substituent. The presence of the chloromethyl group indicates that it can participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. The cyclopropyl group contributes to the compound's unique steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents suggests it may be used in various applications, including pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as the chloromethyl group can pose hazards associated with reactivity and toxicity.
Formula:C12H15ClO
InChI:InChI=1S/C12H15ClO/c1-9(11-5-6-11)14-12-4-2-3-10(7-12)8-13/h2-4,7,9,11H,5-6,8H2,1H3
InChI key:InChIKey=YDCOFURRFHTJHI-UHFFFAOYSA-N
SMILES:C(OC1=CC(CCl)=CC=C1)(C)C2CC2
Synonyms:- Benzene, 1-(chloromethyl)-3-(1-cyclopropylethoxy)-
- 1-(Chloromethyl)-3-(1-cyclopropylethoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.