CymitQuimica logo

CAS 921605-76-7

:

tert-butyl 4-[2-(trifluoromethyl)phenoxy]piperidine-1-carboxylate

Description:
Tert-butyl 4-[2-(trifluoromethyl)phenoxy]piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a tert-butyl ester group, and a phenoxy moiety substituted with a trifluoromethyl group. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents due to its hydrophobic tert-butyl group and the presence of the aromatic phenoxy structure. The trifluoromethyl group is known to enhance lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. The presence of the piperidine ring suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system. Additionally, the compound's unique functional groups may contribute to its reactivity and interaction with biological targets. Overall, tert-butyl 4-[2-(trifluoromethyl)phenoxy]piperidine-1-carboxylate represents a versatile structure with potential applications in various fields, including drug discovery and development.
Formula:C17H22F3NO3
InChI:InChI=1/C17H22F3NO3/c1-16(2,3)24-15(22)21-10-8-12(9-11-21)23-14-7-5-4-6-13(14)17(18,19)20/h4-7,12H,8-11H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)Oc1ccccc1C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.