CAS 92168-88-2

5-undecyl-1H-1,2,4-triazol-3-amine

Description:

5-Undecyl-1H-1,2,4-triazol-3-amine is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an undecyl chain, contributing to its hydrophobic properties, which can influence its solubility and interaction with biological membranes. The presence of an amine group enhances its potential for hydrogen bonding, making it a candidate for various applications in pharmaceuticals and agrochemicals. The triazole moiety is known for its role in antifungal and antimicrobial activities, suggesting that this compound may exhibit similar biological properties. Additionally, the length of the undecyl chain may affect its lipophilicity, potentially impacting its pharmacokinetics and bioavailability. Overall, 5-undecyl-1H-1,2,4-triazol-3-amine presents a unique structure that may be explored for various chemical and biological applications, particularly in the development of new therapeutic agents.

Formula: C₁₃H₂₆N₄

InChI: InChI=1/C13H26N4/c1-2-3-4-5-6-7-8-9-10-11-12-15-13(14)17-16-12/h2-11H2,1H3,(H3,14,15,16,17)