CymitQuimica logo

CAS 921753-34-6

:

3,3-Difluorocyclohexanamine

Description:
3,3-Difluorocyclohexanamine is an organic compound characterized by the presence of a cyclohexane ring substituted with two fluorine atoms at the 3-position and an amine group. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of fluorine atoms imparts unique properties, such as increased lipophilicity and potential bioactivity, making it of interest in medicinal chemistry and material science. The amine functional group contributes to its basicity and reactivity, allowing for various chemical transformations. 3,3-Difluorocyclohexanamine may exhibit interesting interactions with biological systems, potentially influencing its pharmacological profile. Additionally, its molecular structure can lead to distinct physical properties, such as boiling and melting points, which are influenced by the steric and electronic effects of the fluorine substituents. Safety and handling precautions are essential due to the potential reactivity of the amine group and the environmental implications of fluorinated compounds.
Formula:C6H11F2N
InChI:InChI=1S/C6H11F2N/c7-6(8)3-1-2-5(9)4-6/h5H,1-4,9H2
InChI key:InChIKey=VAQNIUDWPOLHBT-UHFFFAOYSA-N
SMILES:FC1(F)CC(N)CCC1
Synonyms:
  • 3,3-Difluorocyclohexan-1-amine
  • 3,3-Difluorocyclohexylamine
  • Cyclohexanamine, 3,3-Difluoro-
  • 3,3-Difluorocyclohexanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.