CAS 921753-37-9
:2,2-difluorocyclohexanamine
Description:
2,2-Difluorocyclohexanamine is an organic compound characterized by the presence of a cyclohexane ring substituted with two fluorine atoms at the 2-position and an amino group (-NH2) at the same carbon. This compound is part of the class of amines and exhibits properties typical of both cyclic and fluorinated compounds. The introduction of fluorine atoms can significantly influence the compound's reactivity, polarity, and overall stability, often enhancing its lipophilicity and altering its interaction with biological systems. The amino group contributes to its basicity and potential for hydrogen bonding, which can affect solubility in various solvents. 2,2-Difluorocyclohexanamine may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its unique structural features. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would need to be determined through experimental data, as they can vary based on environmental conditions and the presence of other functional groups.
Formula:C6H11F2N
InChI:InChI=1/C6H11F2N/c7-6(8)4-2-1-3-5(6)9/h5H,1-4,9H2
SMILES:C1CCC(C(C1)N)(F)F
Synonyms:- Cyclohexanamine, 2,2-Difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.