CAS 92188-49-3
:1-(3-Methoxyphenyl)-2-(methylamino)ethanol
Description:
1-(3-Methoxyphenyl)-2-(methylamino)ethanol, with the CAS number 92188-49-3, is an organic compound characterized by its structure, which includes a methoxy group attached to a phenyl ring and an ethanolamine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in polar solvents due to the presence of the hydroxyl group. It may display biological activity, potentially interacting with neurotransmitter systems, which is common for compounds containing amino and hydroxyl functional groups. The methoxy group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions. As with many organic compounds, its stability can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and potential toxicity, as compounds with amine functionalities can exhibit varying degrees of biological activity. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and pharmacology, warranting further investigation into its properties and effects.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-11-7-10(12)8-4-3-5-9(6-8)13-2/h3-6,10-12H,7H2,1-2H3
SMILES:CNCC(c1cccc(c1)OC)O
Synonyms:- Benzenemethanol, 3-Methoxy-Alpha-[(Methylamino)Methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

