CAS 921938-71-8

5-isocyanato-1-methyl-indoline

Description:

5-Isocyanato-1-methyl-indoline is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to the indoline structure, which is a bicyclic compound consisting of a fused benzene and pyrrole ring. This compound typically exhibits properties associated with isocyanates, such as being reactive towards nucleophiles, which makes it useful in various chemical synthesis applications, including the production of polyurethanes and other polymers. The presence of the methyl group at the 1-position of the indoline ring can influence its reactivity and solubility. Additionally, compounds containing isocyanate groups are known for their potential toxicity and irritant properties, necessitating careful handling and appropriate safety measures during use. The molecular structure of 5-isocyanato-1-methyl-indoline contributes to its unique chemical behavior, making it a subject of interest in both industrial and research settings.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c1-12-5-4-8-6-9(11-7-13)2-3-10(8)12/h2-3,6H,4-5H2,1H3

SMILES: CN1CCc2cc(ccc12)N=C=O

1-Methylindolin-5-yl isocyanate

CAS: 921938-71-8

1-Methylindolin-5-yl isocyanate

Purity: ≥95%

Color and Shape: Yellow Liquid

Molecular weight: 174.20g/mol

Ref: 54-OR15963