CAS 921938-78-5

4-(2-methylimidazol-1-yl)benzoic acid hydrate hydrochloride

Description:

4-(2-Methylimidazol-1-yl)benzoic acid hydrate hydrochloride is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a 2-methylimidazole group. This compound typically exists as a hydrochloride salt, enhancing its solubility in aqueous solutions, which is beneficial for various applications, including pharmaceutical formulations. The presence of the imidazole ring contributes to its potential biological activity, as imidazole derivatives are often involved in enzyme inhibition and receptor interactions. The hydrate form indicates that the compound contains water molecules in its crystalline structure, which can influence its stability and solubility. This compound may exhibit properties such as moderate acidity due to the carboxylic acid group, and it may participate in hydrogen bonding due to the presence of both the carboxylic acid and the imidazole nitrogen. Overall, its characteristics make it a subject of interest in medicinal chemistry and related fields.

Formula: C₁₁H₁₃ClN₂O₃

InChI: InChI=1/C11H10N2O2.ClH.H2O/c1-8-12-6-7-13(8)10-4-2-9(3-5-10)11(14)15;;/h2-7H,1H3,(H,14,15);1H;1H2

SMILES: Cc1nccn1c1ccc(cc1)C(=O)O.Cl.O

4-(2-Methyl-1H-imidazol-1-yl)benzoic acid hydrochloride hydrate

CAS: 921938-78-5

4-(2-Methyl-1H-imidazol-1-yl)benzoic acid hydrochloride hydrate

Purity: ≥95%

Color and Shape: Pale Yellow Solid

Molecular weight: 256.69g/mol

Ref: 54-OR12219