CAS 921938-81-0

(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)methanol

Description:

(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)methanol is a chemical compound characterized by its complex bicyclic structure, which includes a pyridine and an oxazine ring. This compound features a hydroxymethyl group (-CH2OH) attached to the nitrogen-containing heterocycle, which can influence its reactivity and solubility. The presence of the methyl group at the 4-position of the pyridine ring contributes to its steric and electronic properties, potentially affecting its biological activity. The compound may exhibit various functional properties, including potential interactions with biological targets, making it of interest in medicinal chemistry. Its unique structure may also confer specific physical properties, such as solubility in polar solvents and stability under certain conditions. As with many heterocyclic compounds, it may participate in diverse chemical reactions, including nucleophilic substitutions and cyclization processes. Overall, this compound's characteristics make it a subject of interest for further research in pharmacology and organic synthesis.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1/C9H12N2O2/c1-11-2-3-13-8-4-7(6-12)5-10-9(8)11/h4-5,12H,2-3,6H2,1H3

SMILES: CN1CCOc2cc(cnc12)CO

3,4-Dihydro-7-(hydroxymethyl)-4-methyl-2H-pyrido[3,2-b][1,4]oxazine

CAS: 921938-81-0

3,4-Dihydro-7-(hydroxymethyl)-4-methyl-2H-pyrido[3,2-b][1,4]oxazine

Purity: 97%

Color and Shape: Yellow Solid

Molecular weight: 180.20g/mol

Ref: 54-OR12406