CAS 921938-85-4

N-methyl-1-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)methanamine

Description:

N-methyl-1-(4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazin-7-yl)methanamine is a chemical compound characterized by its complex structure, which includes a dihydropyrido moiety fused with an oxazine ring. This compound features a methyl group attached to the nitrogen atom of the amine, contributing to its N-methyl designation. The presence of the dihydropyrido structure suggests potential biological activity, as many compounds with similar frameworks are investigated for pharmacological properties. The oxazine ring adds to the compound's stability and may influence its reactivity and solubility. Typically, such compounds are studied for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The specific characteristics, such as melting point, solubility, and spectral properties, would require experimental determination or detailed literature references. Overall, this compound exemplifies the intricate nature of organic molecules that can exhibit diverse chemical behavior and biological significance.

Formula: C₁₀H₁₅N₃O

InChI: InChI=1/C10H15N3O/c1-11-6-8-5-9-10(12-7-8)13(2)3-4-14-9/h5,7,11H,3-4,6H2,1-2H3

SMILES: CNCc1cc2c(nc1)N(C)CCO2

3,4-Dihydro-4-methyl-7-[(methylamino)methyl]-2H-pyrido[3,2-b][1,4]oxazine

CAS: 921938-85-4

3,4-Dihydro-4-methyl-7-[(methylamino)methyl]-2H-pyrido[3,2-b][1,4]oxazine

Purity: 97%

Molecular weight: 193.25g/mol

Ref: 54-OR12415